![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/compressed.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 8. Efficient genome monomer higher order structure annotation and identification using the GRMhor algorithm.zip | 2024-04-22 23:41 | 5.4M | |
| 4. ijms-24-12029.pdf | 2024-04-22 23:41 | 5.3M | |
| članci.pdf | 2024-04-22 23:41 | 148K | |
| 9. Poglavlje u knjizi_Screenshot 2024-03-05 at 09.24.29.png | 2024-04-22 23:41 | 392K | |
| 7. Precise identification of Cascading alpha satellite higher order repeats (HORs) in T2T-CHM13 assembly of human chromosome 3 .zip | 2024-04-22 23:41 | 3.3M | |
| 6. ijms-25-04395.pdf | 2024-04-22 23:41 | 2.9M | |
| 3. genes-14-02200-v2.pdf | 2024-04-22 23:41 | 4.0M | |
| 5. algorithms-15-00458-v2.pdf | 2024-04-22 23:41 | 3.2M | |
| 2. scientific_reports41598-023-41517-3.pdf | 2024-04-22 23:41 | 1.4M | |
| 1. LSA-2021-01306.pdf | 2024-04-22 23:41 | 1.3M | |